N-methyl-N-phenyl-N-propan-2-yl-prop-2-enimidamide structure
|
Common Name | N-methyl-N-phenyl-N-propan-2-yl-prop-2-enimidamide | ||
|---|---|---|---|---|
| CAS Number | 50871-07-3 | Molecular Weight | 202.29500 | |
| Density | 0.89g/cm3 | Boiling Point | 279.5ºC at 760 mmHg | |
| Molecular Formula | C13H18N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.8ºC | |
| Name | (Z)-N'-isopropyl-N-methyl-N-phenylacrylimidamide |
|---|
| Density | 0.89g/cm3 |
|---|---|
| Boiling Point | 279.5ºC at 760 mmHg |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.29500 |
| Flash Point | 122.8ºC |
| Exact Mass | 202.14700 |
| PSA | 15.60000 |
| LogP | 3.11570 |
| Index of Refraction | 1.499 |
| InChIKey | ZXXKQTPSWYDGQC-UHFFFAOYSA-N |
| SMILES | C=CC(=NC(C)C)N(C)c1ccccc1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |