2,3,5,6-tetrachloro-4,4-dimethoxypentacyclo[5.4.0.0^{2,6}.0^{3,10}.0^{5,9}]undecane-8,11-dione structure
|
Common Name | 2,3,5,6-tetrachloro-4,4-dimethoxypentacyclo[5.4.0.0^{2,6}.0^{3,10}.0^{5,9}]undecane-8,11-dione | ||
|---|---|---|---|---|
| CAS Number | 50874-39-0 | Molecular Weight | 372.02800 | |
| Density | 1.8g/cm3 | Boiling Point | 488.5ºC at 760 mmHg | |
| Molecular Formula | C13H10Cl4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.5ºC | |
| Name | 2,3,5,6-tetrachloro-4,4-dimethoxypentacyclo[5.4.0.0^{2,6}.0^{3,10}.0^{5,9}]undecane-8,11-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8g/cm3 |
|---|---|
| Boiling Point | 488.5ºC at 760 mmHg |
| Molecular Formula | C13H10Cl4O4 |
| Molecular Weight | 372.02800 |
| Flash Point | 203.5ºC |
| Exact Mass | 369.93300 |
| PSA | 52.60000 |
| LogP | 1.55690 |
| Index of Refraction | 1.648 |
| InChIKey | IXQXXDRHGCNCJI-UHFFFAOYSA-N |
| SMILES | COC1(OC)C2(Cl)C3C(=O)C4C5C(=O)C3C1(Cl)C5(Cl)C42Cl |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4,4-dimethoxy-2,3,5,6-tetrachloropentacyclo<5.4.0.02.6.03.10.05.9>undecane-8.11-dione |
| 2,3,5,6-tetrachloro-4,4-dimethoxypentacyclo[5.4.0.0~2,6~.0~3,10~.0~5,9~]undecane-8,11-dione |