2-Amino-3-hydroxy-3-(4-methoxyphenyl)propanoic acid structure
|
Common Name | 2-Amino-3-hydroxy-3-(4-methoxyphenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 50897-30-8 | Molecular Weight | 211.21500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | β-Hydroxy-O-methyltyrosine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13NO4 |
|---|---|
| Molecular Weight | 211.21500 |
| Exact Mass | 211.08400 |
| PSA | 92.78000 |
| LogP | 0.84080 |
| InChIKey | YEMITEDRQMFNKS-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(O)C(N)C(=O)O)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-amino-3-hydroxyestra-1(10),2,4-trien-17-one |
| 2-Amino-3-hydroxy-1,3,5(10)-estratrien-17-one |
| 2-Amino-3-hydroxy-oestra-1,3,5(10)-trien-17-on |
| 2-Aminoestron |
| 2-amino-3-hydroxy-estra-1,3,5(10)-trien-17-one |
| 2-Amino-3-hydroxy-3-(4-methoxy-phenyl)-propionsaeure |
| 2-Aminoestrone |
| 2-amino-3-hydroxy-3-(4-methoxy-phenyl)-propionic acid |