3',6'-diaminospiro[2-benzofuran-3,9'-xanthene]-1-one structure
|
Common Name | 3',6'-diaminospiro[2-benzofuran-3,9'-xanthene]-1-one | ||
|---|---|---|---|---|
| CAS Number | 509-72-8 | Molecular Weight | 330.337 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 620.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C20H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.6±27.8 °C | |
| Name | 3',6'-diaminospiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 620.7±55.0 °C at 760 mmHg |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.337 |
| Flash Point | 317.6±27.8 °C |
| Exact Mass | 330.100433 |
| PSA | 87.57000 |
| LogP | 0.95 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.779 |
| InChIKey | ACNUVXZPCIABEX-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(c1)Oc1cc(N)ccc1C21OC(=O)c2ccccc21 |
| HS Code | 2932999099 |
|---|
|
~%
3',6'-diaminosp... CAS#:509-72-8 |
| Literature: BASF Patent: DE44002 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 2, p. 68 Full Text Show Details Meyer,R.; Sundmacher Chemische Berichte, 1899 , vol. 32, p. 2123 |
|
~%
3',6'-diaminosp... CAS#:509-72-8 |
| Literature: Meyer,R.; Sundmacher Chemische Berichte, 1899 , vol. 32, p. 2123 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3',6'-Fluorandiamine |
| Fluoran,3',6'-diamino |
| rhodamine 110 hydrochloride salt |
| 3',6'-Diaminofluoran |
| Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 3',6'-diamino- |
| 3',6'-Diamino-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one |