1-(N,N-dimethyl-N'-phenylcarbamimidoyl)-3,3-dimethyl-1-phenylthiourea structure
|
Common Name | 1-(N,N-dimethyl-N'-phenylcarbamimidoyl)-3,3-dimethyl-1-phenylthiourea | ||
|---|---|---|---|---|
| CAS Number | 50904-50-2 | Molecular Weight | 326.45900 | |
| Density | 1.06g/cm3 | Boiling Point | 425ºC at 760mmHg | |
| Molecular Formula | C18H22N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.8ºC | |
| Name | 1-(N,N-dimethyl-N'-phenylcarbamimidoyl)-3,3-dimethyl-1-phenylthiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 425ºC at 760mmHg |
| Molecular Formula | C18H22N4S |
| Molecular Weight | 326.45900 |
| Flash Point | 210.8ºC |
| Exact Mass | 326.15700 |
| PSA | 54.17000 |
| LogP | 3.58880 |
| Index of Refraction | 1.576 |
| InChIKey | ZNEADDSVMDPULD-UHFFFAOYSA-N |
| SMILES | CN(C)C(=S)N(C(=Nc1ccccc1)N(C)C)c1ccccc1 |
| HS Code | 2930909090 |
|---|
|
~86%
1-(N,N-dimethyl... CAS#:50904-50-2 |
| Literature: Barrett, Anthony G. M.; Barton, Derek H. R.; Colle, Roberto Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 665 - 671 |
|
~72%
1-(N,N-dimethyl... CAS#:50904-50-2 |
| Literature: Barrett, Anthony G. M.; Barton, Derek H. R.; Colle, Roberto Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 665 - 671 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Phenyl-1-<N-phenyl-N',N'-dimethyl-guanyl>-3,3-dimethyl-thiocarbamid |
| EINECS 256-835-8 |
| 1-<N.N-Dimethyl-N'-phenyl-guanyl>-1-phenyl-3.3-dimethyl-thiocarbamid |