2-[5-(4-Chloro-phenyl)-tetrazol-2-yl]-ethanol
Modify Date: 2025-11-10 12:08:06
![2-[5-(4-Chloro-phenyl)-tetrazol-2-yl]-ethanol Structure](https://www.chemsrc.com/extcaspic/000/50907-40-9.png)
2-[5-(4-Chloro-phenyl)-tetrazol-2-yl]-ethanol structure
|
Common Name | 2-[5-(4-Chloro-phenyl)-tetrazol-2-yl]-ethanol | ||
|---|---|---|---|---|
| CAS Number | 50907-40-9 | Molecular Weight | 224.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9ClN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[5-(4-Chloro-phenyl)-tetrazol-2-yl]-ethanol |
|---|
| Molecular Formula | C9H9ClN4O |
|---|---|
| Molecular Weight | 224.65 |
| InChIKey | IHOMCLNYBYFARY-UHFFFAOYSA-N |
| SMILES | OCCn1nnc(-c2ccc(Cl)cc2)n1 |
|
Name: In vitro inhibitory activity against rat brain Monoamine oxidase A
Source: ChEMBL
Target: Amine oxidase [flavin-containing] A
External Id: CHEMBL733230
|
|
Name: In vitro inhibitory activity against rat brain Monoamine oxidase B
Source: ChEMBL
Target: Amine oxidase [flavin-containing] B
External Id: CHEMBL729461
|
|
Name: Selectivity for the B form was estimated by the IC50(MAO A)/IC50(MAO B) ratio
Source: ChEMBL
Target: Amine oxidase [flavin-containing] B
External Id: CHEMBL848743
|
Total 3, Current Page 1 of 1
1