50909-46-1
Modify Date: 2022-11-21 19:07:18
50909-46-1 structure
|
Common Name | N/A | ||
|---|---|---|---|---|
| CAS Number | 50909-46-1 | Molecular Weight | 214.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7KN2O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| No information of Name |
| Molecular Formula | C9H7KN2O2 |
|---|---|
| Molecular Weight | 214.26200 |
| Exact Mass | 214.01400 |
| PSA | 50.09000 |
| LogP | 2.17798 |
| InChIKey | HZBHQPNPJVDRMR-UHFFFAOYSA-M |
| SMILES | N#C[N-]C(=O)OCc1ccccc1.[K+] |
| RIDADR | NONH for all modes of transport |
|---|
|
Looper; R. E.; et. al.
J. Org. Chem. 76 , 6957, (2011)
|