Mocravimod structure
|
Common Name | Mocravimod | ||
|---|---|---|---|---|
| CAS Number | 509092-16-4 | Molecular Weight | 443.98600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H26ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MocravimodMocravimod is an oral activity amphematoshenol-1-1-phosphate receptor (S1PR) regulator, which can block the required signal from lymph organs to prevent the migration of effect cells from migrating to non-lymph hematopoietic tissue. Mocravimod can be used for cancer research[1]. |
| Name | 2-amino-2-[2-(4-{[3-(benzyloxy)phenyl]thio}-2-chlorophenyl)ethyl]propane-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Description | Mocravimod is an oral activity amphematoshenol-1-1-phosphate receptor (S1PR) regulator, which can block the required signal from lymph organs to prevent the migration of effect cells from migrating to non-lymph hematopoietic tissue. Mocravimod can be used for cancer research[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H26ClNO3S |
|---|---|
| Molecular Weight | 443.98600 |
| Exact Mass | 443.13200 |
| PSA | 101.01000 |
| LogP | 5.38520 |
| InChIKey | IINUNQPYJGJCJI-UHFFFAOYSA-N |
| SMILES | NC(CO)(CO)CCc1ccc(Sc2cccc(OCc3ccccc3)c2)cc1Cl |
| KNF-299 |
| 2-amino-2-[4-(benzyloxyphenylthio)-2-chlorophenyl]ethyl-1,3-propane-diol |
| 2-amino-2-{2-[4-(3-benzyloxyphenylsulfanyl)-2-chlorophenyl]ethyl}propane-1,3-diol |
| 2-amino-2-{2-[4-(3-benzyloxyphenylthio)-2-chlorophenyl]-ethyl}propan-1,3-diol |
| 2-amino-2-[2-[4-(3-benzyloxyphenylthio)-2-chlorophenyl]ethyl]-1,3-propanediol |
| 2-amino-2-[4-(3-benzyloxyphenylthio)-2-chlorophenyl]ethyl-1,3-propanediol |