[2-hydroxy-3-(4-methylphenyl)sulfinyl-propyl] acetate structure
|
Common Name | [2-hydroxy-3-(4-methylphenyl)sulfinyl-propyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 50921-24-9 | Molecular Weight | 256.31800 | |
| Density | 1.28g/cm3 | Boiling Point | 466.6ºC at 760 mmHg | |
| Molecular Formula | C12H16O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236ºC | |
| Name | [2-hydroxy-3-(4-methylphenyl)sulfinylpropyl] acetate |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 466.6ºC at 760 mmHg |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.31800 |
| Flash Point | 236ºC |
| Exact Mass | 256.07700 |
| PSA | 82.81000 |
| LogP | 1.89230 |
| Index of Refraction | 1.581 |
| InChIKey | NPUSVVAWIRPEGC-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(O)CS(=O)c1ccc(C)cc1 |
|
~%
[2-hydroxy-3-(4... CAS#:50921-24-9 |
| Literature: Iriuchijima,S. et al. Journal of Organic Chemistry, 1974 , vol. 39, # 8 p. 1170 - 1171 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |