N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-2-propyl-1,3-thiazole-5-carboxamide structure
|
Common Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-2-propyl-1,3-thiazole-5-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 50930-37-5 | Molecular Weight | 416.58000 | |
| Density | 1.144g/cm3 | Boiling Point | 623.5ºC at 760 mmHg | |
| Molecular Formula | C22H32N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.9ºC | |
| Name | N-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-2-propyl-1,3-thiazole-5-carboxamide |
|---|
| Density | 1.144g/cm3 |
|---|---|
| Boiling Point | 623.5ºC at 760 mmHg |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.58000 |
| Flash Point | 330.9ºC |
| Exact Mass | 416.22500 |
| PSA | 89.43000 |
| LogP | 4.01410 |
| Index of Refraction | 1.568 |
| InChIKey | REFLFKYHVAUXNF-UHFFFAOYSA-N |
| SMILES | CCCc1ncc(C(=O)NCCCCN2CCN(c3ccccc3OC)CC2)s1 |
| HS Code | 2934100090 |
|---|
|
~%
N-[4-[4-(2-meth... CAS#:50930-37-5 |
| Literature: Roussel-UCLAF Patent: US3966950 A1, 1976 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |