3-(isopropyl)-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-dioxide, compound with dimethylamine (1:1) structure
|
Common Name | 3-(isopropyl)-1H-2,1,3-benzothiadiazin-4(3H)-one 2,2-dioxide, compound with dimethylamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 50930-44-4 | Molecular Weight | 285.36300 | |
| Density | N/A | Boiling Point | 395.7ºC at 760mmHg | |
| Molecular Formula | C12H19N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.1ºC | |
| Name | 2,2-dioxo-3-propan-2-yl-1H-2λ6,1,3-benzothiadiazin-4-one,N-methylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 395.7ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.36300 |
| Flash Point | 193.1ºC |
| Exact Mass | 285.11500 |
| PSA | 86.89000 |
| LogP | 2.59070 |
| InChIKey | MYSPVTCSNUEPHX-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=O)c2ccccc2NS1(=O)=O.CNC |
| einecs 256-855-7 |