2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethanol structure
|
Common Name | 2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethanol | ||
|---|---|---|---|---|
| CAS Number | 50997-69-8 | Molecular Weight | 276.12400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H8F8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H8F8O2 |
|---|---|
| Molecular Weight | 276.12400 |
| Exact Mass | 276.04000 |
| PSA | 29.46000 |
| LogP | 2.16630 |
| InChIKey | AYSXBVDLZTWPRI-UHFFFAOYSA-N |
| SMILES | OCCOCC(F)(F)C(F)(F)C(F)(F)C(F)F |
|
~66%
2-(2,2,3,3,4,4,... CAS#:50997-69-8 |
| Literature: Minnesota Mining and Manufacturing Company Patent: US5157159 A1, 1992 ; |
|
~76%
2-(2,2,3,3,4,4,... CAS#:50997-69-8 |
| Literature: Chiang, Y. H.; Ames, A. E.; Gaudiana, R. A.; Adams, T. G. Molecular Crystals and Liquid Crystals (1969-1991), 1991 , vol. 208, p. 85 - 98 |
|
~%
2-(2,2,3,3,4,4,... CAS#:50997-69-8 |
| Literature: Chiang, Y. H.; Ames, A. E.; Gaudiana, R. A.; Adams, T. G. Molecular Crystals and Liquid Crystals (1969-1991), 1991 , vol. 208, p. 85 - 98 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1H,1H,5H-octafluoro-1-pentoxyethanol |
| 1,1,5-trihydroperfluoropentyl 2-hydroxyethyl ether |