Hydroperoxide,1,1'-(dioxydicycloheptylidene)bis- structure
|
Common Name | Hydroperoxide,1,1'-(dioxydicycloheptylidene)bis- | ||
|---|---|---|---|---|
| CAS Number | 51008-02-7 | Molecular Weight | 290.35300 | |
| Density | 1.19g/cm3 | Boiling Point | 433.7ºC at 760mmHg | |
| Molecular Formula | C14H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.1ºC | |
| Name | 1-hydroperoxy-1-(1-hydroperoxycycloheptyl)peroxycycloheptane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 433.7ºC at 760mmHg |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.35300 |
| Flash Point | 216.1ºC |
| Exact Mass | 290.17300 |
| PSA | 77.38000 |
| LogP | 4.01480 |
| Index of Refraction | 1.512 |
| InChIKey | VCBLWXWIMGVUAQ-UHFFFAOYSA-N |
| SMILES | OOC1(OOC2(OO)CCCCCC2)CCCCCC1 |
|
~43%
Hydroperoxide,1... CAS#:51008-02-7 |
| Literature: Terent'ev, Alexander O.; Platonov, Maxim M.; Tursina, Anna I.; Chernyshev, Vladimir V.; Nikishin, Gennady I. Journal of Organic Chemistry, 2008 , vol. 73, # 8 p. 3169 - 3174 |
|
~%
Hydroperoxide,1... CAS#:51008-02-7 |
| Literature: Terent'ev, Alexander O.; Borisov, Alexander M.; Platonov, Maxim M.; Starikova, Zoya A.; Chernyshev, Vladimir V.; Nikishin, Gennady I. Synthesis, 2009 , # 24 art. no. P10509SS, p. 4159 - 4166 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,1'-bis(hydroperoxy)bis(cycloheptyl)peroxide |
| 1.1'-Dihydroperoxi-dicycloheptyl-peroxid |
| 1,1'-dihydroperoxydi(cycloheptyl)peroxide |
| bis(1-hydroperoxycycloheptyl) peroxide |