4-oxo-4-(3,4,5-trimethoxyphenyl)butanoic acid structure
|
Common Name | 4-oxo-4-(3,4,5-trimethoxyphenyl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 5101-00-8 | Molecular Weight | 268.26300 | |
| Density | 1.215g/cm3 | Boiling Point | 449.9ºC at 760 mmHg | |
| Molecular Formula | C13H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.7ºC | |
| Name | 4-oxo-4-(3,4,5-trimethoxyphenyl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.215g/cm3 |
|---|---|
| Boiling Point | 449.9ºC at 760 mmHg |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26300 |
| Flash Point | 169.7ºC |
| Exact Mass | 268.09500 |
| PSA | 82.06000 |
| LogP | 1.75990 |
| Index of Refraction | 1.52 |
| InChIKey | VBPGSDAYADHUML-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)CCC(=O)O)cc(OC)c1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-oxo-4-(3,4,5-trimethoxy-phenyl)-butyric acid |
| 4-Oxo-4-(3,4,5-trimethoxy-phenyl)-buttersaeure |
| 3-(3,4,5-trimethoxybenzoyl)propionic acid |
| 4-(3,4,5-trimethoxyphenyl)-4-oxobutanoic acid |
| 4-(3,4,5-trimethoxyphenyl)-4-oxobutyric acid |