9H-Purin-6-amine,8-(1,4-dioxan-2-yl)- structure
|
Common Name | 9H-Purin-6-amine,8-(1,4-dioxan-2-yl)- | ||
|---|---|---|---|---|
| CAS Number | 51015-51-1 | Molecular Weight | 221.21600 | |
| Density | 1.503g/cm3 | Boiling Point | 591.5ºC at 760 mmHg | |
| Molecular Formula | C9H11N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.5ºC | |
| Name | 8-(1,4-dioxan-2-yl)-7H-purin-6-amine |
|---|
| Density | 1.503g/cm3 |
|---|---|
| Boiling Point | 591.5ºC at 760 mmHg |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.21600 |
| Flash Point | 311.5ºC |
| Exact Mass | 221.09100 |
| PSA | 98.94000 |
| LogP | 0.60420 |
| Index of Refraction | 1.7 |
| InChIKey | INMZMQMKRICKLQ-UHFFFAOYSA-N |
| SMILES | Nc1ncnc2nc(C3COCCO3)[nH]c12 |
|
~%
9H-Purin-6-amin... CAS#:51015-51-1 |
| Literature: Leonor; Elad The Journal of organic chemistry, 1974 , vol. 39, # 11 p. 1470 - 1473 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |