8-(oxan-2-yl)-7H-purin-6-amine structure
|
Common Name | 8-(oxan-2-yl)-7H-purin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 51015-52-2 | Molecular Weight | 219.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-(oxan-2-yl)-7H-purin-6-amine |
|---|
| Molecular Formula | C10H13N5O |
|---|---|
| Molecular Weight | 219.24300 |
| Exact Mass | 219.11200 |
| PSA | 89.71000 |
| LogP | 1.75790 |
| InChIKey | NTHFSWJUBJKLSX-UHFFFAOYSA-N |
| SMILES | Nc1ncnc2nc(C3CCCCO3)[nH]c12 |
|
~%
8-(oxan-2-yl)-7... CAS#:51015-52-2 |
| Literature: Leonor; Elad The Journal of organic chemistry, 1974 , vol. 39, # 11 p. 1470 - 1473 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |