1,10-bis(phenyl-propan-2-yloxy-phosphoryl)decane structure
|
Common Name | 1,10-bis(phenyl-propan-2-yloxy-phosphoryl)decane | ||
|---|---|---|---|---|
| CAS Number | 51021-91-1 | Molecular Weight | 506.59400 | |
| Density | 1.06g/cm3 | Boiling Point | 579.8ºC at 760 mmHg | |
| Molecular Formula | C28H44O4P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.3ºC | |
| Name | [10-[phenyl(propan-2-yloxy)phosphoryl]decyl-propan-2-yloxyphosphoryl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 579.8ºC at 760 mmHg |
| Molecular Formula | C28H44O4P2 |
| Molecular Weight | 506.59400 |
| Flash Point | 317.3ºC |
| Exact Mass | 506.27100 |
| PSA | 72.22000 |
| LogP | 8.16440 |
| Index of Refraction | 1.512 |
| InChIKey | YOEXMSZZNSDOPE-UHFFFAOYSA-N |
| SMILES | CC(C)OP(=O)(CCCCCCCCCCP(=O)(OC(C)C)c1ccccc1)c1ccccc1 |
|
~%
1,10-bis(phenyl... CAS#:51021-91-1 |
| Literature: Chan,T.H.; Ong,B.S. Journal of Organic Chemistry, 1974 , vol. 39, # 12 p. 1748 - 1752 |
|
~%
1,10-bis(phenyl... CAS#:51021-91-1 |
| Literature: Chan,T.H.; Ong,B.S. Journal of Organic Chemistry, 1974 , vol. 39, # 12 p. 1748 - 1752 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| P,P'-diphenyl-P,P'-decane-1,10-diyl-bis-phosphinic acid diisopropyl ester |