Sulnidazole
Modify Date: 2024-01-03 10:34:29
Sulnidazole structure
|
Common Name | Sulnidazole | ||
|---|---|---|---|---|
| CAS Number | 51022-76-5 | Molecular Weight | 258.29700 | |
| Density | 1.37g/cm3 | Boiling Point | 429.6ºC at 760mmHg | |
| Molecular Formula | C9H14N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.6ºC | |
| Name | O-methyl N-[2-(2-ethyl-5-nitroimidazol-1-yl)ethyl]carbamothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 429.6ºC at 760mmHg |
| Molecular Formula | C9H14N4O3S |
| Molecular Weight | 258.29700 |
| Flash Point | 213.6ºC |
| Exact Mass | 258.07900 |
| PSA | 116.99000 |
| LogP | 1.78870 |
| Index of Refraction | 1.613 |
| InChIKey | BDRFWSJMVOBAHR-UHFFFAOYSA-N |
| SMILES | CCc1ncc([N+](=O)[O-])n1CCNC(=S)OC |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Sulnidazol |
| Sulnidazole |
| UNII-504LR309YV |
| Sulnidazolum |
| Sulnidazole (USAN/INN) |
| [2-(2-ethyl-5-nitro-imidazol-1-yl)-ethyl]-thiocarbamic acid O-methyl ester |