ethene,1,1,1,3,3,3-hexafluoropropan-2-one,1,1,2,2-tetrafluoroethene structure
|
Common Name | ethene,1,1,1,3,3,3-hexafluoropropan-2-one,1,1,2,2-tetrafluoroethene | ||
|---|---|---|---|---|
| CAS Number | 51023-51-9 | Molecular Weight | 294.09000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4F10O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethene,1,1,1,3,3,3-hexafluoropropan-2-one,1,1,2,2-tetrafluoroethene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H4F10O |
|---|---|
| Molecular Weight | 294.09000 |
| Exact Mass | 294.01000 |
| PSA | 17.07000 |
| LogP | 4.47330 |
| InChIKey | DYHCATUVYVHZSE-UHFFFAOYSA-N |
| SMILES | C=C.FC(F)=C(F)F.O=C(C(F)(F)F)C(F)(F)F |
| 2-Propanone,1,1,1,3,3,3-hexafluoro-,polymer with ethene and 1,1,2,2-tetrafluoroethene |
| Ethylene,tetrafluoroethylene,hexafluoro-2-propanone polymer |
| 2-Propanone,1,1,1,3,3,3-hexafluoro-,polymer with ethene and tetrafluoroethene |