1-Methyl-3-(3-nitrophenyl)triazene structure
|
Common Name | 1-Methyl-3-(3-nitrophenyl)triazene | ||
|---|---|---|---|---|
| CAS Number | 51029-19-7 | Molecular Weight | 180.16400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H8N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(methyldiazenyl)-3-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H8N4O2 |
|---|---|
| Molecular Weight | 180.16400 |
| Exact Mass | 180.06500 |
| PSA | 82.57000 |
| LogP | 2.59990 |
| InChIKey | MBPWPKALLCRCBL-UHFFFAOYSA-N |
| SMILES | CN=NNc1cccc([N+](=O)[O-])c1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1-m-Nitrophenyl-3-methyltriazen |