dimethyl 1,2,3,6,7,8-hexahydro-as-indacene-4,5-dicarboxylate structure
|
Common Name | dimethyl 1,2,3,6,7,8-hexahydro-as-indacene-4,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 51037-20-8 | Molecular Weight | 274.31200 | |
| Density | 1.227g/cm3 | Boiling Point | 445.4ºC at 760 mmHg | |
| Molecular Formula | C16H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.3ºC | |
| Name | dimethyl 1,2,3,6,7,8-hexahydro-as-indacene-4,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 445.4ºC at 760 mmHg |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.31200 |
| Flash Point | 228.3ºC |
| Exact Mass | 274.12100 |
| PSA | 52.60000 |
| LogP | 2.23720 |
| Index of Refraction | 1.578 |
| InChIKey | KBCJLXMMXAYTTB-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c2c(c3c(c1C(=O)OC)CCC3)CCC2 |
|
~25%
dimethyl 1,2,3,... CAS#:51037-20-8 |
| Literature: Buttler, Thomas; Fleming, Ian; Gonsior, Sabine; Kim, Bo-Hye; Sung, A.-Young; Woo, Hee-Gweon Organic and Biomolecular Chemistry, 2005 , vol. 3, # 8 p. 1557 - 1567 |
|
~%
dimethyl 1,2,3,... CAS#:51037-20-8 |
| Literature: Courtot,P.; Clement,J.-C. Bulletin de la Societe Chimique de France, 1973 , p. 2121 - 2125 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,2,3,6,7,8-hexahydro-As-indacene-4,5-dicarboxylic acid dimethyl ester |
| Dimethyl-dicyclopentanophthalat |
| 1,2,3,6,7,8-Hexahydro-as-indacen-4,5-dicarbonsaeure-dimethylester |