buta-1,3-diene-1,1,2,3,4,4-hexacarbonitrile structure
|
Common Name | buta-1,3-diene-1,1,2,3,4,4-hexacarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 5104-27-8 | Molecular Weight | 204.14700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | buta-1,3-diene-1,1,2,3,4,4-hexacarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10N6 |
|---|---|
| Molecular Weight | 204.14700 |
| Exact Mass | 204.01800 |
| PSA | 142.74000 |
| LogP | 0.72108 |
| InChIKey | XKHYPFFZHSGMBE-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)=C(C#N)C(C#N)=C(C#N)C#N |
| HS Code | 2926909090 |
|---|
|
~%
buta-1,3-diene-... CAS#:5104-27-8 |
| Literature: Webster,O.W. Journal of the American Chemical Society, 1964 , vol. 86, p. 2898 - 2902 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| hexacyanobutadiene |
| 1,3-Butadiene-1,1,2,3,4,4-hexacarbonitrile |
| Hexacyanobutadien |