ethyl 2-(5-oxo-5,6,7,8-tetrahydronaphthalen-2-yloxy)acetate structure
|
Common Name | ethyl 2-(5-oxo-5,6,7,8-tetrahydronaphthalen-2-yloxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 51062-76-1 | Molecular Weight | 248.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[(5-oxo-7,8-dihydro-6H-naphthalen-2-yl)oxy]acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16O4 |
|---|---|
| Molecular Weight | 248.27400 |
| Exact Mass | 248.10500 |
| PSA | 52.60000 |
| LogP | 2.14750 |
| InChIKey | ROYVAKOZYYVODU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COc1ccc2c(c1)CCCC2=O |
| HS Code | 2918990090 |
|---|
|
~74%
ethyl 2-(5-oxo-... CAS#:51062-76-1 |
| Literature: Miyake; Itoh; Tada; Tanabe; Hirata; Oka Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 7 p. 2329 - 2348 |
|
~%
ethyl 2-(5-oxo-... CAS#:51062-76-1 |
| Literature: Rossello, Armando; Orlandini, Elisabetta; Nuti, Elisa; Rapposelli, Simona; Macchia, Marco; Di Modugno, Enza; Balsamo, Aldo Farmaco, 2004 , vol. 59, # 9 p. 691 - 696 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ethyl 2-(5-oxo-5,6,7,8-tetrahydronaphthalen-2-yloxy)acetate |
| ethoxycarbonylmethoxynaphthalenone |
| ethyl [(5-oxo-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]acetate |