2,3,4,9-tetrahydro-6-hydroxy-1H-pyrido[3,4-b]indol-1-one structure
|
Common Name | 2,3,4,9-tetrahydro-6-hydroxy-1H-pyrido[3,4-b]indol-1-one | ||
|---|---|---|---|---|
| CAS Number | 51085-95-1 | Molecular Weight | 202.20900 | |
| Density | 1.447g/cm3 | Boiling Point | 617.4ºC at 760mmHg | |
| Molecular Formula | C11H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 327.2ºC | |
| Name | 6-hydroxy-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.447g/cm3 |
|---|---|
| Boiling Point | 617.4ºC at 760mmHg |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.20900 |
| Flash Point | 327.2ºC |
| Exact Mass | 202.07400 |
| PSA | 65.12000 |
| LogP | 1.48820 |
| Index of Refraction | 1.735 |
| InChIKey | WNGPRJOWLUNBCE-UHFFFAOYSA-N |
| SMILES | O=C1NCCc2c1[nH]c1ccc(O)cc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| kb-NB123-59 |
| 6-Hydroxy-3,4-dihydro-1-oxo-b-carboline |
| EINECS 256-961-3 |