1-butan-2-yl-3-cyclohexylimidazolidine-2,4,5-trione structure
|
Common Name | 1-butan-2-yl-3-cyclohexylimidazolidine-2,4,5-trione | ||
|---|---|---|---|---|
| CAS Number | 5109-75-1 | Molecular Weight | 252.30900 | |
| Density | 1.206g/cm3 | Boiling Point | 390.2ºC at 760 mmHg | |
| Molecular Formula | C13H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.7ºC | |
| Name | 1-butan-2-yl-3-cyclohexylimidazolidine-2,4,5-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.206g/cm3 |
|---|---|
| Boiling Point | 390.2ºC at 760 mmHg |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.30900 |
| Flash Point | 169.7ºC |
| Exact Mass | 252.14700 |
| PSA | 57.69000 |
| LogP | 1.78420 |
| Index of Refraction | 1.539 |
| InChIKey | NKRWEHRJGRRCHY-UHFFFAOYSA-N |
| SMILES | CCC(C)N1C(=O)C(=O)N(C2CCCCC2)C1=O |
| HS Code | 2921440000 |
|---|
| HS Code | 2921440000 |
|---|---|
| Summary | 2921440000. diphenylamine and its derivatives; salts thereof. VAT:17.0%. Tax rebate rate:17.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Nitro-4'-chlor-N-methyl-diphenylamin |