Ethyl 5-oxo-3-thioxo-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxylate structure
|
Common Name | Ethyl 5-oxo-3-thioxo-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 51101-09-8 | Molecular Weight | 201.20300 | |
| Density | 1.62g/cm3 | Boiling Point | 279.8ºC at 760 mmHg | |
| Molecular Formula | C6H7N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123ºC | |
| Name | ethyl 5-oxo-3-sulfanylidene-2H-1,2,4-triazine-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 279.8ºC at 760 mmHg |
| Molecular Formula | C6H7N3O3S |
| Molecular Weight | 201.20300 |
| Flash Point | 123ºC |
| Exact Mass | 201.02100 |
| PSA | 119.93000 |
| LogP | 0.00420 |
| Index of Refraction | 1.685 |
| InChIKey | CVUZWTLCUJJDHG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1n[nH]c(=S)[nH]c1=O |
| HS Code | 2933699090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| Ethyl 5-oxo-3-thioxo-2,3,4,5-tetrahydro-1,2,4-triazine-6-carboxylate |
| 5-Oxo-3-thioxo-2,3,4,5-tetrahydro-[1,2,4]triazin-6-carbonsaeure-aethylester |
| 5-oxo-3-thioxo-2,3,4,5-tetrahydro-[1,2,4]triazine-6-carboxylic acid ethyl ester |