Benzene,1-chloro-4-[(3,7-dimethyl-6-octen-1-yl)oxy] structure
|
Common Name | Benzene,1-chloro-4-[(3,7-dimethyl-6-octen-1-yl)oxy] | ||
|---|---|---|---|---|
| CAS Number | 51113-64-5 | Molecular Weight | 266.80600 | |
| Density | 0.996g/cm3 | Boiling Point | 358.2ºC at 760mmHg | |
| Molecular Formula | C16H23ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.9ºC | |
| Name | 1-chloro-4-(3,7-dimethyloct-6-enoxy)benzene |
|---|
| Density | 0.996g/cm3 |
|---|---|
| Boiling Point | 358.2ºC at 760mmHg |
| Molecular Formula | C16H23ClO |
| Molecular Weight | 266.80600 |
| Flash Point | 169.9ºC |
| Exact Mass | 266.14400 |
| PSA | 9.23000 |
| LogP | 5.49140 |
| Index of Refraction | 1.504 |
| InChIKey | XTMWJIOAKUBVIF-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCC(C)CCOc1ccc(Cl)cc1 |
|
~%
Benzene,1-chlor... CAS#:51113-64-5 |
| Literature: Phadnis, A. P.; Nanda, B.; Patwardhan, Sarita A.; Powar, P.; Sharma, R. N. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 9 p. 867 - 870 |
|
~%
Benzene,1-chlor... CAS#:51113-64-5 |
| Literature: Phadnis, A. P.; Nanda, B.; Patwardhan, Sarita A.; Powar, P.; Sharma, R. N. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 9 p. 867 - 870 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |