N-ethyl-2,2-diisopropyl butanamide structure
|
Common Name | N-ethyl-2,2-diisopropyl butanamide | ||
|---|---|---|---|---|
| CAS Number | 51115-70-9 | Molecular Weight | 199.33300 | |
| Density | 0.854g/cm3 | Boiling Point | 259.1ºC at 760mmHg | |
| Molecular Formula | C12H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.6ºC | |
| Name | N,2-diethyl-3-methyl-2-propan-2-ylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.854g/cm3 |
|---|---|
| Boiling Point | 259.1ºC at 760mmHg |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.33300 |
| Flash Point | 152.6ºC |
| Exact Mass | 199.19400 |
| PSA | 32.59000 |
| LogP | 3.67120 |
| Index of Refraction | 1.437 |
| InChIKey | PCOMMNVANAQDMV-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C(CC)(C(C)C)C(C)C |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Ethyl-2,2-diisopropylbutanamide |
| EINECS 256-978-6 |