3-benzo[1,3]dioxol-5-yl-1-(3,4-dimethoxyphenyl)prop-2-en-1-one
![3-benzo[1,3]dioxol-5-yl-1-(3,4-dimethoxyphenyl)prop-2-en-1-one Structure](https://image.chemsrc.com/caspic/406/51116-22-4.png)
3-benzo[1,3]dioxol-5-yl-1-(3,4-dimethoxyphenyl)prop-2-en-1-one structure
|
Common Name | 3-benzo[1,3]dioxol-5-yl-1-(3,4-dimethoxyphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 51116-22-4 | Molecular Weight | 312.31700 | |
| Density | 1.254g/cm3 | Boiling Point | 487.3ºC at 760 mmHg | |
| Molecular Formula | C18H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.6ºC | |
Summary: 3-(1,3-Benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one (Chinese name: 3-(1,3-苯并二氧杂环戊-5-基)-1-(3,4-二甲氧基苯基)丙-2-烯-1-酮, CAS number: 51116-22-4, molecular formula: C18H16O5, molecular weight: 312.31700), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.254g/cm3 |
|---|---|
| Boiling Point | 487.3ºC at 760 mmHg |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.31700 |
| Flash Point | 216.6ºC |
| Exact Mass | 312.10000 |
| PSA | 53.99000 |
| LogP | 3.32860 |
| Index of Refraction | 1.612 |
| InChIKey | FBXJBLNGPPHWDT-ZZXKWVIFSA-N |
| SMILES | COc1ccc(C(=O)C=Cc2ccc3c(c2)OCO3)cc1OC |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:614-47-1![1,3-Benzodioxole-5-acetonitrile,a-[2-(3,4-dimethoxyphenyl)-2-oxoethyl] structure](https://image.chemsrc.com/caspic/368/51116-23-5.png)
CAS#:51116-23-5This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2',4'-Dimethoxy-3,4-methylenedioxychalcone |
| 3',4'-Dimethoxy-3,4-methylenedioxychalcone |
| 3',4'-Dimethoxy-3,4-methylendioxychalcon |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one? |
| A: LogP of 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one is 3.32860. |
| Q: What is the molecular formula of 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one? |
| A: Molecular formula of 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one is C18H16O5. |
| Q: What is the English name of 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one? |
| A: The English name of 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one is 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one. |
| Q: What English synonyms does 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one have? |
| A: English synonyms of 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one: 2',4'-Dimethoxy-3,4-methylenedioxychalcone, 3',4'-Dimethoxy-3,4-methylenedioxychalcone, 3',4'-Dimethoxy-3,4-methylendioxychalcon. |
| Q: What is the boiling point of 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one? |
| A: Boiling point of 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one is 487.3ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one? |
| A: Polar surface area (PSA) of 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one is 53.99000. |
| Q: What is the InChIKey of 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one? |
| A: InChIKey of 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one is FBXJBLNGPPHWDT-ZZXKWVIFSA-N. |
| Q: What is the SMILES notation of 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one? |
| A: SMILES notation of 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one is COc1ccc(C(=O)C=Cc2ccc3c(c2)OCO3)cc1OC. |
| Q: What is the Chinese name of 51116-22-4? |
| A: Chinese name of 51116-22-4 is 51116-22-4. |
| Q: What is the molecular weight of 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one? |
| A: Molecular weight of 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one is 312.31700. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |