3-benzo[1,3]dioxol-5-yl-1-(3,4-dimethoxyphenyl)prop-2-en-1-one structure
|
Common Name | 3-benzo[1,3]dioxol-5-yl-1-(3,4-dimethoxyphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 51116-22-4 | Molecular Weight | 312.31700 | |
| Density | 1.254g/cm3 | Boiling Point | 487.3ºC at 760 mmHg | |
| Molecular Formula | C18H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.6ºC | |
| Name | 3-(1,3-benzodioxol-5-yl)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.254g/cm3 |
|---|---|
| Boiling Point | 487.3ºC at 760 mmHg |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.31700 |
| Flash Point | 216.6ºC |
| Exact Mass | 312.10000 |
| PSA | 53.99000 |
| LogP | 3.32860 |
| Index of Refraction | 1.612 |
| InChIKey | FBXJBLNGPPHWDT-ZZXKWVIFSA-N |
| SMILES | COc1ccc(C(=O)C=Cc2ccc3c(c2)OCO3)cc1OC |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2',4'-Dimethoxy-3,4-methylenedioxychalcone |
| 3',4'-Dimethoxy-3,4-methylenedioxychalcone |
| 3',4'-Dimethoxy-3,4-methylendioxychalcon |