1-(4-chloro-2-nitrophenyl)sulfonylpyrrole
1-(4-chloro-2-nitrophenyl)sulfonylpyrrole structure
|
Common Name | 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole | ||
|---|---|---|---|---|
| CAS Number | 51144-97-9 | Molecular Weight | 286.69200 | |
| Density | 1.57g/cm3 | Boiling Point | 465.1ºC at 760 mmHg | |
| Molecular Formula | C10H7ClN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.1ºC | |
Summary: 1-(4-Chloro-2-nitrophenyl)sulfonylpyrrole, Chinese name: 1-(4-氯-2-硝基苯基)硫基吡咯, CAS number: 51144-97-9, molecular formula: C10H7ClN2O4S, molecular weight: 286.69200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 465.1ºC at 760 mmHg |
| Molecular Formula | C10H7ClN2O4S |
| Molecular Weight | 286.69200 |
| Flash Point | 235.1ºC |
| Exact Mass | 285.98200 |
| PSA | 93.27000 |
| LogP | 3.89070 |
| Index of Refraction | 1.662 |
| InChIKey | NZZRUBKPFOEDEL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1S(=O)(=O)n1cccc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933990090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~24%
1-(4-chloro-2-n... CAS#:51144-97-9 |
| Literature: Artico; Silvestri; Stefancich; Massa; Pagnozzi; Musu; Scintu; Pinna; Tinti; La Colla Archiv der Pharmazie, 1995 , vol. 328, # 3 p. 223 - 229 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Effective concentration against HIV-1 induced cytopathogenicity in MT-4 cells
Source: ChEMBL
Target: MT4
External Id: CHEMBL712401
|
|
Name: Concentration required to reduce the viability of mock-infected MT-4 cells by 50%
Source: ChEMBL
Target: MT4
External Id: CHEMBL709816
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole? |
| A: The English name of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole is 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole. |
| Q: What is the LogP of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole? |
| A: LogP of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole is 3.89070. |
| Q: What are the upstream materials of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole? |
| A: Related upstream materials(CAS) of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole: 109-97-7;4533-96-4. |
| Q: What is the polar surface area (PSA) of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole? |
| A: Polar surface area (PSA) of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole is 93.27000. |
| Q: What is the molecular weight of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole? |
| A: Molecular weight of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole is 286.69200. |
| Q: What is the InChIKey of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole? |
| A: InChIKey of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole is NZZRUBKPFOEDEL-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole? |
| A: Molecular formula of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole is C10H7ClN2O4S. |
| Q: What is the SMILES notation of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole? |
| A: SMILES notation of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole is O=[N+]([O-])c1cc(Cl)ccc1S(=O)(=O)n1cccc1. |
| Q: What is the boiling point of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole? |
| A: Boiling point of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole is 465.1ºC at 760 mmHg. |
| Q: What is the CAS number of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole? |
| A: CAS number of 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole is 51144-97-9. |