1-(4-chloro-2-nitrophenyl)sulfonylpyrrole
Modify Date: 2025-08-26 11:45:26
1-(4-chloro-2-nitrophenyl)sulfonylpyrrole structure
|
Common Name | 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole | ||
|---|---|---|---|---|
| CAS Number | 51144-97-9 | Molecular Weight | 286.69200 | |
| Density | 1.57g/cm3 | Boiling Point | 465.1ºC at 760 mmHg | |
| Molecular Formula | C10H7ClN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.1ºC | |
| Name | 1-(4-chloro-2-nitrophenyl)sulfonylpyrrole |
|---|
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 465.1ºC at 760 mmHg |
| Molecular Formula | C10H7ClN2O4S |
| Molecular Weight | 286.69200 |
| Flash Point | 235.1ºC |
| Exact Mass | 285.98200 |
| PSA | 93.27000 |
| LogP | 3.89070 |
| Index of Refraction | 1.662 |
| InChIKey | NZZRUBKPFOEDEL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1S(=O)(=O)n1cccc1 |
| HS Code | 2933990090 |
|---|
|
~24%
1-(4-chloro-2-n... CAS#:51144-97-9 |
| Literature: Artico; Silvestri; Stefancich; Massa; Pagnozzi; Musu; Scintu; Pinna; Tinti; La Colla Archiv der Pharmazie, 1995 , vol. 328, # 3 p. 223 - 229 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Effective concentration against HIV-1 induced cytopathogenicity in MT-4 cells
Source: ChEMBL
Target: MT4
External Id: CHEMBL712401
|
|
Name: Concentration required to reduce the viability of mock-infected MT-4 cells by 50%
Source: ChEMBL
Target: MT4
External Id: CHEMBL709816
|
Total 3, Current Page 1 of 1
1