Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate
Modify Date: 2025-09-23 11:05:36
![Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate Structure](https://www.chemsrc.com/extcaspic/451/511552-45-7.png)
Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate structure
|
Common Name | Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate | ||
|---|---|---|---|---|
| CAS Number | 511552-45-7 | Molecular Weight | 228.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H20N2O3 |
|---|---|
| Molecular Weight | 228.29 |
| InChIKey | XKCASRKNACVGFN-UHFFFAOYSA-N |
| SMILES | COC(=O)CCNC(=O)NC1CCCCC1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Tested for 50 % inhibitory concentration against human soluble epoxide hydrolase (sEH...
Source: ChEMBL
Target: Bifunctional epoxide hydrolase 2
External Id: CHEMBL677485
|
|
Name: Tested for 50 % inhibitory concentration against mouse soluble epoxide hydrolase (sEH...
Source: ChEMBL
Target: Bifunctional epoxide hydrolase 2
External Id: CHEMBL677487
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate? |
| A: SMILES notation of Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate is COC(=O)CCNC(=O)NC1CCCCC1. |
| Q: What is the CAS number of Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate? |
| A: CAS number of Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate is 511552-45-7. |
| Q: What is the Chinese name of 511552-45-7? |
| A: Chinese name of 511552-45-7 is 511552-45-7. |
| Q: What is the molecular weight of Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate? |
| A: Molecular weight of Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate is 228.29. |
| Q: What is the molecular formula of Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate? |
| A: Molecular formula of Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate is C11H20N2O3. |
| Q: What is the InChIKey of Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate? |
| A: InChIKey of Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate is XKCASRKNACVGFN-UHFFFAOYSA-N. |
| Q: What is the English name of Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate? |
| A: The English name of Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate is Methyl 3-[(cyclohexylcarbamoyl)amino]propanoate. |