2,6-DI-O-METHYL-ALPHA-CYCLODEXTRIN
Modify Date: 2026-07-12 18:27:13
2,6-DI-O-METHYL-ALPHA-CYCLODEXTRIN structure
|
Common Name | 2,6-DI-O-METHYL-ALPHA-CYCLODEXTRIN | ||
|---|---|---|---|---|
| CAS Number | 51166-72-4 | Molecular Weight | 1033.07000 | |
| Density | 1.39g/cm3 | Boiling Point | 1099.2ºC at 760mmHg | |
| Molecular Formula | C48H72O24 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 618.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dimethyl-α-cyclodextrin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 1099.2ºC at 760mmHg |
| Molecular Formula | C48H72O24 |
| Molecular Weight | 1033.07000 |
| Flash Point | 618.5ºC |
| Exact Mass | 1032.44000 |
| PSA | 334.56000 |
| Index of Refraction | 1.549 |
| InChIKey | GTXJHJOCVPTNTP-MLJFYOOPSA-N |
| SMILES | COCC1OC2OC3C(COC)OC(OC4C(COC)OC(OC5C(COC)OC(OC6C(COC)OC(OC7C(COC)OC(OC1C(O)C2OC)C(OC)C7O)C(OC)C6O)C(OC)C5O)C(OC)C4O)C(OC)C3O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Dimethyl-α-cyclodextrin? |
| A: Molecular weight of Dimethyl-α-cyclodextrin is 1033.07000. |
| Q: What is the polar surface area (PSA) of Dimethyl-α-cyclodextrin? |
| A: Polar surface area (PSA) of Dimethyl-α-cyclodextrin is 334.56000. |
| Q: What is the SMILES notation of Dimethyl-α-cyclodextrin? |
| A: SMILES notation of Dimethyl-α-cyclodextrin is COCC1OC2OC3C(COC)OC(OC4C(COC)OC(OC5C(COC)OC(OC6C(COC)OC(OC7C(COC)OC(OC1C(O)C2OC)C(OC)C7O)C(OC)C6O)C(OC)C5O)C(OC)C4O)C(OC)C3O. |
| Q: What is the English name of Dimethyl-α-cyclodextrin? |
| A: The English name of Dimethyl-α-cyclodextrin is Dimethyl-α-cyclodextrin. |
| Q: What is the InChIKey of Dimethyl-α-cyclodextrin? |
| A: InChIKey of Dimethyl-α-cyclodextrin is GTXJHJOCVPTNTP-MLJFYOOPSA-N. |
| Q: What is the molecular formula of Dimethyl-α-cyclodextrin? |
| A: Molecular formula of Dimethyl-α-cyclodextrin is C48H72O24. |
| Q: What is the boiling point of Dimethyl-α-cyclodextrin? |
| A: Boiling point of Dimethyl-α-cyclodextrin is 1099.2ºC at 760mmHg. |
| Q: What is the CAS number of Dimethyl-α-cyclodextrin? |
| A: CAS number of Dimethyl-α-cyclodextrin is 51166-72-4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |