1-[(2-bromophenyl)-(2,5-dimethylphenyl)methyl]piperidine-3-carboxylic acid
Modify Date: 2025-09-23 19:56:04
![1-[(2-bromophenyl)-(2,5-dimethylphenyl)methyl]piperidine-3-carboxylic acid Structure](https://image.chemsrc.com/caspic/169/5117-71-5.png)
1-[(2-bromophenyl)-(2,5-dimethylphenyl)methyl]piperidine-3-carboxylic acid structure
|
Common Name | 1-[(2-bromophenyl)-(2,5-dimethylphenyl)methyl]piperidine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 5117-71-5 | Molecular Weight | 402.32500 | |
| Density | 1.338g/cm3 | Boiling Point | 508ºC at 760 mmHg | |
| Molecular Formula | C21H24BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261ºC | |
| Name | 1-[(2-bromophenyl)-(2,5-dimethylphenyl)methyl]piperidine-3-carboxylic acid |
|---|
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 508ºC at 760 mmHg |
| Molecular Formula | C21H24BrNO2 |
| Molecular Weight | 402.32500 |
| Flash Point | 261ºC |
| Exact Mass | 401.09900 |
| PSA | 40.54000 |
| LogP | 4.88980 |
| Index of Refraction | 1.605 |
| InChIKey | JTZZGQVFCQFGSI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c(C(c2ccccc2Br)N2CCCC(C(=O)O)C2)c1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |