N-(2,4-dichlorophenyl)-1-(2-ethylbut-1-enyl)pyrrolidin-2-imine structure
|
Common Name | N-(2,4-dichlorophenyl)-1-(2-ethylbut-1-enyl)pyrrolidin-2-imine | ||
|---|---|---|---|---|
| CAS Number | 51170-85-5 | Molecular Weight | 311.24900 | |
| Density | 1.17g/cm3 | Boiling Point | 416.8ºC at 760 mmHg | |
| Molecular Formula | C16H20Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.9ºC | |
| Name | N-(2,4-dichlorophenyl)-1-(2-ethylbut-1-enyl)pyrrolidin-2-imine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 416.8ºC at 760 mmHg |
| Molecular Formula | C16H20Cl2N2 |
| Molecular Weight | 311.24900 |
| Flash Point | 205.9ºC |
| Exact Mass | 310.10000 |
| PSA | 15.60000 |
| LogP | 5.76100 |
| Index of Refraction | 1.569 |
| InChIKey | WACSFSYXYAOTHK-UHFFFAOYSA-N |
| SMILES | CCC(=CN1CCCC1=Nc1ccc(Cl)cc1Cl)CC |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzenamine,2,4-dichloro-N-(1-(2-ethyl-1-butenyl)-2-pyrrolidinylidene) |
| 2,4-Dichloro-N-(1-(2-ethyl-1-butenyl)-2-pyrrolidinylidene)benzenamine |
| Pyrrolidine,2-((2,4-dichlorophenyl)imino)-1-(2-ethyl-1-butenyl) |