6,6'-(m-phenylene)bis(1,3,5-triazine-2,4-diamine) structure
|
Common Name | 6,6'-(m-phenylene)bis(1,3,5-triazine-2,4-diamine) | ||
|---|---|---|---|---|
| CAS Number | 5118-80-9 | Molecular Weight | 296.29100 | |
| Density | 1.114g/cm3 | Boiling Point | 432.7ºC at 760 mmHg | |
| Molecular Formula | C12H12N10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.8ºC | |
| Name | 6,6'-(1,3-phenylene)bis(1,3,5-triazine-2,4-diamine) |
|---|
| Density | 1.114g/cm3 |
|---|---|
| Boiling Point | 432.7ºC at 760 mmHg |
| Molecular Formula | C12H12N10 |
| Molecular Weight | 296.29100 |
| Flash Point | 181.8ºC |
| Exact Mass | 296.12500 |
| PSA | 181.42000 |
| LogP | 2.04420 |
| Index of Refraction | 1.555 |
| InChIKey | SVOFLTDQIZSKLN-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)nc(-c2cccc(-c3nc(N)nc(N)n3)c2)n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |