1,2,2,6,6-pentamethyl-4-piperidin-1-ylpiperidine-4-carboxamide structure
|
Common Name | 1,2,2,6,6-pentamethyl-4-piperidin-1-ylpiperidine-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 51192-85-9 | Molecular Weight | 281.43700 | |
| Density | 0.996g/cm3 | Boiling Point | 394.2ºC at 760 mmHg | |
| Molecular Formula | C16H31N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.2ºC | |
| Name | 1,2,2,6,6-pentamethyl-4-piperidin-1-ylpiperidine-4-carboxamide |
|---|
| Density | 0.996g/cm3 |
|---|---|
| Boiling Point | 394.2ºC at 760 mmHg |
| Molecular Formula | C16H31N3O |
| Molecular Weight | 281.43700 |
| Flash Point | 192.2ºC |
| Exact Mass | 281.24700 |
| PSA | 50.56000 |
| LogP | 3.00470 |
| Index of Refraction | 1.497 |
| InChIKey | LNCSNTGUCJJMJS-UHFFFAOYSA-N |
| SMILES | CN1C(C)(C)CC(C(N)=O)(N2CCCCC2)CC1(C)C |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |