Tricyclo[2.2.1.02,6]heptane-1-carboxylic acid, 7,7-dimethyl-
Modify Date: 2025-11-19 10:56:56
![Tricyclo[2.2.1.02,6]heptane-1-carboxylic acid, 7,7-dimethyl- Structure](https://image.chemsrc.com/caspic/439/512-60-7.png)
Tricyclo[2.2.1.02,6]heptane-1-carboxylic acid, 7,7-dimethyl- structure
|
Common Name | Tricyclo[2.2.1.02,6]heptane-1-carboxylic acid, 7,7-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 512-60-7 | Molecular Weight | 166.21700 | |
| Density | 1.262g/cm3 | Boiling Point | 263ºC at 760 mmHg | |
| Molecular Formula | C10H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123ºC | |
| Name | 5,5-dimethyl-3,4,6,7-tetrahydro-2H-tricyclo[2.2.1.02,6]heptane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 263ºC at 760 mmHg |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.21700 |
| Flash Point | 123ºC |
| Exact Mass | 166.09900 |
| PSA | 37.30000 |
| LogP | 1.75320 |
| Index of Refraction | 1.578 |
| InChIKey | IRTLURZRAZUXNA-UHFFFAOYSA-N |
| SMILES | CC1(C)C2CC3C(C2)C31C(=O)O |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Dehydrocamphenilsaeure |
| Tricyclensaeure |
| 7,7-Dimethyl-2,6-cyclo-norbornan-1-carbonsaeure |
| 7,7-dimethyl-2,6-cyclo-norbornane-1-carboxylic acid |