Santalene structure
|
Common Name | Santalene | ||
|---|---|---|---|---|
| CAS Number | 512-61-8 | Molecular Weight | 204.35 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 247.6±7.0 °C at 760 mmHg | |
| Molecular Formula | C15H24 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 73.8±14.8 °C | |
Use of Santaleneα-Santalene is a precursor of Sandalwood Oil. |
| Name | 1,7-dimethyl-7-(4-methyl-3-pentenyl)-tricyclo[2.2.1.0(2,6)]heptane |
|---|---|
| Synonym | More Synonyms |
| Description | α-Santalene is a precursor of Sandalwood Oil. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 247.6±7.0 °C at 760 mmHg |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| Flash Point | 73.8±14.8 °C |
| Exact Mass | 204.187805 |
| LogP | 6.20 |
| Vapour Pressure | 0.0±0.2 mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | KWFJIXPIFLVMPM-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCC1(C)C2CC3C(C2)C31C |
| 1,7-Dimethyl-7-(4-methyl-3-penten-1-yl)tricyclo[2.2.1.02,6]heptane |
| Tricyclo(2.2.1.0(2,6))heptane, 1,7-dimethyl-7-(4-methyl-3-pentenyl)-, (-)- |
| Tricyclo[2.2.1.02,6]heptane, 1,7-dimethyl-7-(4-methyl-3-penten-1-yl)- |
| 1,7-dimethyl-7-(4-methyl-3-pentenyl)-tricyclo[2.2.1.0(2,6)]heptane |
| Tricyclo[2.2.1.0(2,6)]heptane, 1,7-dimethyl-7-(4-methyl-3-pentenyl)-, (-)- |