Xylosucrose structure
|
Common Name | Xylosucrose | ||
|---|---|---|---|---|
| CAS Number | 512-66-3 | Molecular Weight | 312.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H20O10 | Melting Point | 114 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of XylosucroseXylosucrose is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | Xylosucrose |
|---|
| Description | Xylosucrose is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Melting Point | 114 °C |
|---|---|
| Molecular Formula | C11H20O10 |
| Molecular Weight | 312.27 |
| Exact Mass | 312.10600 |
| PSA | 169.30000 |
| InChIKey | DRYHSZUFKNRFCT-ROIIQKICSA-N |
| SMILES | OCC1OC(CO)(OC2OCC(O)C(O)C2O)C(O)C1O |