ajugose structure
|
Common Name | ajugose | ||
|---|---|---|---|---|
| CAS Number | 512-72-1 | Molecular Weight | 990.86 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H62O31 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ajugoseAjugose is a hexasaccharide that can be isolated from in the seeds of Vigna mungo L.[1]. |
| Name | ajugose |
|---|
| Description | Ajugose is a hexasaccharide that can be isolated from in the seeds of Vigna mungo L.[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C36H62O31 |
|---|---|
| Molecular Weight | 990.86 |
| Exact Mass | 990.32800 |
| PSA | 506.13000 |
| InChIKey | NCIHJQNXRKJRMJ-HKJJPIHFSA-N |
| SMILES | OCC1OC(OCC2OC(OCC3OC(OCC4OC(OCC5OC(OC6(CO)OC(CO)C(O)C6O)C(O)C(O)C5O)C(O)C(O)C4O)C(O)C(O)C3O)C(O)C(O)C2O)C(O)C(O)C1O |