1-benzo[1,3]dioxol-5-yl-N-(4-chlorophenyl)methanimine structure
|
Common Name | 1-benzo[1,3]dioxol-5-yl-N-(4-chlorophenyl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 51209-71-3 | Molecular Weight | 259.68800 | |
| Density | 1.3g/cm3 | Boiling Point | 403.7ºC at 760 mmHg | |
| Molecular Formula | C14H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.9ºC | |
| Name | 1-(1,3-benzodioxol-5-yl)-N-(4-chlorophenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 403.7ºC at 760 mmHg |
| Molecular Formula | C14H10ClNO2 |
| Molecular Weight | 259.68800 |
| Flash Point | 197.9ºC |
| Exact Mass | 259.04000 |
| PSA | 30.82000 |
| LogP | 3.81930 |
| Index of Refraction | 1.617 |
| InChIKey | CEHKWASWXYORLW-UHFFFAOYSA-N |
| SMILES | Clc1ccc(N=Cc2ccc3c(c2)OCO3)cc1 |
|
~93%
1-benzo[1,3]dio... CAS#:51209-71-3 |
| Literature: Pore, Santosh; Rashinkar, Gajanan; Mote, Kavita; Salunkhe, Rajeshri Chemistry and Biodiversity, 2010 , vol. 7, # 7 p. 1796 - 1800 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Piperonal-(4-chlor-phenylimin) |
| piperonal-(4-chloro-phenylimine) |
| N-[(E)-1,3-benzodioxol-5-ylmethylidene]-4-chloroaniline |
| N-benzo[1,3]dioxol-5-ylmethylene-4-chloro-aniline |
| 5-[(1E)-2-(4-chlorophenyl)-2-azavinyl]-2H-benzo[d]1,3-dioxolane |
| 3,4-methylenedioxyphenylidine-4'-chloro-aniline |