Benzene,1,1'-(1,2-ethenediyl)bis[4-chloro-
Modify Date: 2025-08-25 15:08:25
Benzene,1,1'-(1,2-ethenediyl)bis[4-chloro- structure
|
Common Name | Benzene,1,1'-(1,2-ethenediyl)bis[4-chloro- | ||
|---|---|---|---|---|
| CAS Number | 5121-74-4 | Molecular Weight | 249.13500 | |
| Density | 1.267g/cm3 | Boiling Point | 360ºC at 760 mmHg | |
| Molecular Formula | C14H10Cl2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.2ºC | |
| Name | 1-chloro-4-[2-(4-chlorophenyl)ethenyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.267g/cm3 |
|---|---|
| Boiling Point | 360ºC at 760 mmHg |
| Molecular Formula | C14H10Cl2 |
| Molecular Weight | 249.13500 |
| Flash Point | 167.2ºC |
| Exact Mass | 248.01600 |
| LogP | 5.16380 |
| Index of Refraction | 1.67 |
| InChIKey | WELCIURRBCOJDX-OWOJBTEDSA-N |
| SMILES | Clc1ccc(C=Cc2ccc(Cl)cc2)cc1 |
| HS Code | 2903999090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:3457-46-3| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (E)-1,2-bis(4-chlorophenyl)ethene |
| 4,4'-DICHLORO-TRANS-STILBENE GC |
| (E)-1,2-di(4-chlorophenyl)ethene |
| (E)-1,2-bis(4-chlorophenyl)ethane |
| (E)-1,2-di(4'-chlorophenyl)ethylene |