2H-Pyrrol-2-one, 4-acetyl-5-cyclohexyl-1-(4-fluorophenyl)-1,5-dihydro-3-hydroxy-, (5R)-
Modify Date: 2024-09-24 09:20:34
2H-Pyrrol-2-one, 4-acetyl-5-cyclohexyl-1-(4-fluorophenyl)-1,5-dihydro-3-hydroxy-, (5R)- structure
|
Common Name | 2H-Pyrrol-2-one, 4-acetyl-5-cyclohexyl-1-(4-fluorophenyl)-1,5-dihydro-3-hydroxy-, (5R)- | ||
|---|---|---|---|---|
| CAS Number | 512177-96-7 | Molecular Weight | 317.35500 | |
| Density | 1.309g/cm3 | Boiling Point | 465.5ºC at 760 mmHg | |
| Molecular Formula | C18H20FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.4ºC | |
| Name | 2H-Pyrrol-2-one, 4-acetyl-5-cyclohexyl-1-(4-fluorophenyl)-1,5-dihydro-3-hydroxy-, (5R) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.309g/cm3 |
|---|---|
| Boiling Point | 465.5ºC at 760 mmHg |
| Molecular Formula | C18H20FNO3 |
| Molecular Weight | 317.35500 |
| Flash Point | 235.4ºC |
| Exact Mass | 317.14300 |
| PSA | 57.61000 |
| LogP | 3.58730 |
| Index of Refraction | 1.598 |
| InChIKey | OCLLHHQIVFPUEC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(O)C(=O)N(c2ccc(F)cc2)C1C1CCCCC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (R)-4-[1-(methylheptyl)oxy]phenyl 4-isocyanobenzoate |
| (R)-4-acetyl-5-cyclohexyl-1-(4-fluorophenyl)-3-hydroxy-1,5-dihydro-2H-pyrrol-2-one |
| Benzoic acid,4-isocyano-,4-[[(1R)-1-methylheptyl]oxy]phenyl ester |
| (R)-4-acetyl-1-(4-chlorophenyl)-5-cyclohexyl-3-hydroxy-1,5-dihydro-2H-pyrrol-2-one |