boc-arg(z)-oh structure
|
Common Name | boc-arg(z)-oh | ||
|---|---|---|---|---|
| CAS Number | 51219-18-2 | Molecular Weight | 408.44900 | |
| Density | 1.255g/cm3 | Boiling Point | 569.73ºC at 760 mmHg | |
| Molecular Formula | C19H28N4O6 | Melting Point | 155-165ºC | |
| MSDS | N/A | Flash Point | 298.362ºC | |
| Name | boc-arg(z)-oh |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 569.73ºC at 760 mmHg |
| Melting Point | 155-165ºC |
| Molecular Formula | C19H28N4O6 |
| Molecular Weight | 408.44900 |
| Flash Point | 298.362ºC |
| Exact Mass | 408.20100 |
| PSA | 149.84000 |
| LogP | 3.46770 |
| Index of Refraction | 1.557 |
| InChIKey | FTDCZFJSCZHUMM-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCCN=C(N)NC(=O)OCc1ccccc1)C(=O)O |
| Storage condition | Store at 0°C |
| HS Code | 2925290090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Boc-Arg(Cbz)-OH |
| N-Boc-N'-Cbz-L-arginine |
| (S)-5-(3-((Benzyloxy)carbonyl)guanidino)-2-((tert-butoxycarbonyl)amino)pentanoic acid |
| N7-<(benzyloxy)carbonyl>-N2-<(tert-butoxy)carbonyl>-L-arginine |