N-benzyl-4-chloro-6-methyl-1,3,5-triazin-2-amine structure
|
Common Name | N-benzyl-4-chloro-6-methyl-1,3,5-triazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 5122-28-1 | Molecular Weight | 234.68500 | |
| Density | 1.322g/cm3 | Boiling Point | 447.4ºC at 760 mmHg | |
| Molecular Formula | C11H11ClN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.4ºC | |
| Name | N-benzyl-4-chloro-6-methyl-1,3,5-triazin-2-amine |
|---|
| Density | 1.322g/cm3 |
|---|---|
| Boiling Point | 447.4ºC at 760 mmHg |
| Molecular Formula | C11H11ClN4 |
| Molecular Weight | 234.68500 |
| Flash Point | 224.4ºC |
| Exact Mass | 234.06700 |
| PSA | 53.93000 |
| LogP | 1.86740 |
| Index of Refraction | 1.645 |
| InChIKey | HVGYEHVEUMVURM-UHFFFAOYSA-N |
| SMILES | Cc1nc(Cl)nc(NCc2ccccc2)n1 |
| HS Code | 2933699090 |
|---|
|
~%
N-benzyl-4-chlo... CAS#:5122-28-1 |
| Literature: Hirt et al. Helvetica Chimica Acta, 1950 , vol. 33, p. 1365,1368 |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |