(4-HYDROXYPIPERIDIN-1-YL)PIPERIDIN-3-YL-METHANONE structure
|
Common Name | (4-HYDROXYPIPERIDIN-1-YL)PIPERIDIN-3-YL-METHANONE | ||
|---|---|---|---|---|
| CAS Number | 51220-54-3 | Molecular Weight | 237.25200 | |
| Density | 1.196g/cm3 | Boiling Point | 463.4ºC at 760 mmHg | |
| Molecular Formula | C12H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234ºC | |
| Name | 2-[(4-propan-2-yloxybenzoyl)amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 463.4ºC at 760 mmHg |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25200 |
| Flash Point | 234ºC |
| Exact Mass | 237.10000 |
| PSA | 75.63000 |
| LogP | 1.67910 |
| Index of Refraction | 1.537 |
| InChIKey | YDKJMFDJOJQCSO-UHFFFAOYSA-N |
| SMILES | CC(C)Oc1ccc(C(=O)NCC(=O)O)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
(4-HYDROXYPIPER... CAS#:51220-54-3 |
| Literature: Krchnak, Viktor; Flegelova, Zuzka; Weichsel, Aleksandra S.; Lebl, Michal Tetrahedron Letters, 1995 , vol. 36, # 35 p. 6193 - 6196 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-hydroxybenzoyl-glycine isopropyl ether |
| N-p-isopropyloxybenzoylglycine |