2,2,3,3,4,4,4-heptafluoro-N-(1-phenylethyl)butanamide structure
|
Common Name | 2,2,3,3,4,4,4-heptafluoro-N-(1-phenylethyl)butanamide | ||
|---|---|---|---|---|
| CAS Number | 51241-61-3 | Molecular Weight | 317.20300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10F7NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3,3,4,4,4-heptafluoro-N-(1-phenylethyl)butanamide |
|---|
| Molecular Formula | C12H10F7NO |
|---|---|
| Molecular Weight | 317.20300 |
| Exact Mass | 317.06500 |
| PSA | 32.59000 |
| LogP | 4.53700 |
| InChIKey | XVGDQPCIRYTQHC-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)C(F)(F)C(F)(F)C(F)(F)F)c1ccccc1 |
|
~%
2,2,3,3,4,4,4-h... CAS#:51241-61-3 |
| Literature: Katritzky; He; Suzuki Journal of Organic Chemistry, 2000 , vol. 65, # 24 p. 8210 - 8213 |
|
~%
2,2,3,3,4,4,4-h... CAS#:51241-61-3 |
| Literature: Matin; Rowland Journal of pharmaceutical sciences, 1972 , vol. 61, # 8 p. 1235 - 1240 |