N-(4-chlorophenyl)-1-(5-methylfuran-2-yl)methanimine structure
|
Common Name | N-(4-chlorophenyl)-1-(5-methylfuran-2-yl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 51305-59-0 | Molecular Weight | 219.66700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-chlorophenyl)-1-(5-methylfuran-2-yl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10ClNO |
|---|---|
| Molecular Weight | 219.66700 |
| Exact Mass | 219.04500 |
| PSA | 25.50000 |
| LogP | 3.99200 |
| InChIKey | BOPFIWQDWJDPHN-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C=Nc2ccc(Cl)cc2)o1 |
|
~%
N-(4-chlorophen... CAS#:51305-59-0 |
| Literature: Klepo; Jakopcic Journal of Chemical and Engineering Data, 1985 , vol. 30, # 2 p. 235 - 237 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Chlor-N-<-anilin |
| HMS1581C03 |
| N-<5-Methyl-furfuryliden>-p-chloranilin |