2-(2-fluorophenyl)-2H-1,2,3-triazole-4-carboxylic acid structure
|
Common Name | 2-(2-fluorophenyl)-2H-1,2,3-triazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 51306-44-6 | Molecular Weight | 207.16100 | |
| Density | 1.49g/cm3 | Boiling Point | 432.7ºC at 760 mmHg | |
| Molecular Formula | C9H6FN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.5ºC | |
| Name | 2-(2-fluorophenyl)triazole-4-carboxylic acid |
|---|
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 432.7ºC at 760 mmHg |
| Molecular Formula | C9H6FN3O2 |
| Molecular Weight | 207.16100 |
| Flash Point | 215.5ºC |
| Exact Mass | 207.04400 |
| PSA | 68.01000 |
| LogP | 1.10460 |
| Index of Refraction | 1.652 |
| InChIKey | FFPUYYDCLFRZGG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cnn(-c2ccccc2F)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |