1,1-Dimethylethyl (4-(1,1-dimethylethyl)phenyl)methyl-3-pyridinylcarbonimidodithioate structure
|
Common Name | 1,1-Dimethylethyl (4-(1,1-dimethylethyl)phenyl)methyl-3-pyridinylcarbonimidodithioate | ||
|---|---|---|---|---|
| CAS Number | 51308-57-7 | Molecular Weight | 372.59000 | |
| Density | 1.122g/cm3 | Boiling Point | 479.8ºC at 760mmHg | |
| Molecular Formula | C21H28N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244ºC | |
| Name | [1-(4-tert-butylphenyl)-2,2-dimethylpropyl] N-pyridin-3-ylcarbamodithioate |
|---|
| Density | 1.122g/cm3 |
|---|---|
| Boiling Point | 479.8ºC at 760mmHg |
| Molecular Formula | C21H28N2S2 |
| Molecular Weight | 372.59000 |
| Flash Point | 244ºC |
| Exact Mass | 372.16900 |
| PSA | 89.35000 |
| LogP | 6.81700 |
| Index of Refraction | 1.611 |
| InChIKey | MIZZFOUKRBLVDP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(SC(=S)Nc2cccnc2)C(C)(C)C)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |